C20H25NO5 — CID 154915892
formic acid;1-[2-(3-methoxyphenoxy)ethyl]-3-(3-methylphenoxy)azetidine (PubChem CID 154915892) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is formic acid;1-[2-(3-methoxyphenoxy)ethyl]-3-(3-methylphenoxy)azetidine.
| Compound Name | formic acid;1-[2-(3-methoxyphenoxy)ethyl]-3-(3-methylphenoxy)azetidine |
|---|---|
| PubChem CID | 154915892 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | formic acid;1-[2-(3-methoxyphenoxy)ethyl]-3-(3-methylphenoxy)azetidine |
| SMILES | COc1cccc(OCCN2CC(Oc3cccc(C)c3)C2)c1.O=CO |
| InChI | InChI=1S/C19H23NO3.CH2O2/c1-15-5-3-8-18(11-15)23-19-13-20(14-19)9-10-22-17-7-4-6-16(12-17)21-2;2-1-3/h3-8,11-12,19H,9-10,13-14H2,1-2H3;1H,(H,2,3) |
| InChIKey | GBXANJSDEGEIAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|