C24H32N2O6 — CID 171710838
formic acid;N-(2-hydroxyethyl)-4-[[1-[2-(3-methoxyphenoxy)ethyl]pyrrolidin-3-yl]methyl]benzamide (PubChem CID 171710838) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is formic acid;N-(2-hydroxyethyl)-4-[[1-[2-(3-methoxyphenoxy)ethyl]pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | formic acid;N-(2-hydroxyethyl)-4-[[1-[2-(3-methoxyphenoxy)ethyl]pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171710838 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | formic acid;N-(2-hydroxyethyl)-4-[[1-[2-(3-methoxyphenoxy)ethyl]pyrrolidin-3-yl]methyl]benzamide |
| SMILES | COc1cccc(OCCN2CCC(Cc3ccc(C(=O)NCCO)cc3)C2)c1.O=CO |
| InChI | InChI=1S/C23H30N2O4.CH2O2/c1-28-21-3-2-4-22(16-21)29-14-12-25-11-9-19(17-25)15-18-5-7-20(8-6-18)23(27)24-10-13-26;2-1-3/h2-8,16,19,26H,9-15,17H2,1H3,(H,24,27);1H,(H,2,3) |
| InChIKey | RNKMXLYFWICSJA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|