C15H22N4O2S — CID 131892694
N-ethyl-N-[methyl-[(5-phenyl-1H-pyrazol-4-yl)methyl]sulfamoyl]ethanamine (PubChem CID 131892694) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-ethyl-N-[methyl-[(5-phenyl-1H-pyrazol-4-yl)methyl]sulfamoyl]ethanamine.
| Compound Name | N-ethyl-N-[methyl-[(5-phenyl-1H-pyrazol-4-yl)methyl]sulfamoyl]ethanamine |
|---|---|
| PubChem CID | 131892694 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-ethyl-N-[methyl-[(5-phenyl-1H-pyrazol-4-yl)methyl]sulfamoyl]ethanamine |
| SMILES | CCN(CC)S(=O)(=O)N(C)Cc1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H22N4O2S/c1-4-19(5-2)22(20,21)18(3)12-14-11-16-17-15(14)13-9-7-6-8-10-13/h6-11H,4-5,12H2,1-3H3,(H,16,17) |
| InChIKey | KFBBXQPOAQCREF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |