C25H25N3 — CID 3914171
N-benzyl-2-phenyl-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 3914171) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is N-benzyl-2-phenyl-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]ethanamine.
| Compound Name | N-benzyl-2-phenyl-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 3914171 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-benzyl-2-phenyl-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | c1ccc(CCN(Cc2ccccc2)Cc2cn[nH]c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3/c1-4-10-21(11-5-1)16-17-28(19-22-12-6-2-7-13-22)20-24-18-26-27-25(24)23-14-8-3-9-15-23/h1-15,18H,16-17,19-20H2,(H,26,27) |
| InChIKey | CALWOJIHEDRGBR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |