C21H32N4O — CID 131892843
1-(3-methoxyphenyl)-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]piperidin-4-amine (PubChem CID 131892843) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]piperidin-4-amine.
| Compound Name | 1-(3-methoxyphenyl)-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 131892843 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 1-(3-methoxyphenyl)-N-[3-(2-propan-2-ylimidazol-1-yl)propyl]piperidin-4-amine |
| SMILES | COc1cccc(N2CCC(NCCCn3ccnc3C(C)C)CC2)c1 |
| InChI | InChI=1S/C21H32N4O/c1-17(2)21-23-11-15-25(21)12-5-10-22-18-8-13-24(14-9-18)19-6-4-7-20(16-19)26-3/h4,6-7,11,15-18,22H,5,8-10,12-14H2,1-3H3 |
| InChIKey | IKGNGVBMRFFIAF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|