About 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine
3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 131893093) has the molecular formula C11H12ClF3N2O2
and a molecular weight of 296.68 g/mol. Its IUPAC name is 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 131893093 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CO[C@H]1COC[C@@H]1Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O2/c1-18-9-5-19-4-8(9)17-10-7(12)2-6(3-16-10)11(13,14)15/h2-3,8-9H,4-5H2,1H3,(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | ILIXLBNJHNFGLM-IUCAKERBSA-N |
| XLogP | 2.58 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine (CID 131893093) is 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine is CO[C@H]1COC[C@@H]1Nc1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is ILIXLBNJHNFGLM-IUCAKERBSA-N. The full InChI is InChI=1S/C11H12ClF3N2O2/c1-18-9-5-19-4-8(9)17-10-7(12)2-6(3-16-10)11(13,14)15/h2-3,8-9H,4-5H2,1H3,(H,16,17)/t8-,9-/m0/s1.
What are the key properties of 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 296.68 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 131893093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).