C17H29N5O — CID 131893140
2-methoxy-5-[[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]methyl]pyrimidine (PubChem CID 131893140) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-methoxy-5-[[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]methyl]pyrimidine.
| Compound Name | 2-methoxy-5-[[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]methyl]pyrimidine |
|---|---|
| PubChem CID | 131893140 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 2-methoxy-5-[[3-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]methyl]pyrimidine |
| SMILES | COc1ncc(CN2CCCC(CN3CCN(C)CC3)C2)cn1 |
| InChI | InChI=1S/C17H29N5O/c1-20-6-8-21(9-7-20)12-15-4-3-5-22(13-15)14-16-10-18-17(23-2)19-11-16/h10-11,15H,3-9,12-14H2,1-2H3 |
| InChIKey | DQHNUFVINNJECY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |