C17H23N5O2 — CID 131893212
N-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide (PubChem CID 131893212) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 131893212 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[1-[4-(2-methoxyethyl)-1,2,4-triazol-3-yl]ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
| SMILES | COCCn1cnnc1C(C)NC(=O)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C17H23N5O2/c1-12(16-21-19-11-22(16)9-10-24-2)20-17(23)14-7-3-5-13-6-4-8-18-15(13)14/h3,5,7,11-12,18H,4,6,8-10H2,1-2H3,(H,20,23) |
| InChIKey | OHPGZJHMWPXHBJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |