C15H19N5O — CID 63330077
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide (PubChem CID 63330077) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 63330077 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
| SMILES | Cn1cnnc1CCNC(=O)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C15H19N5O/c1-20-10-18-19-13(20)7-9-17-15(21)12-6-2-4-11-5-3-8-16-14(11)12/h2,4,6,10,16H,3,5,7-9H2,1H3,(H,17,21) |
| InChIKey | NKNUUGZPRGNBGJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |