C16H24N2O — CID 64599539
N-(2,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline-8-carboxamide (PubChem CID 64599539) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-(2,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 64599539 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(2,3-dimethylbutyl)-1,2,3,4-tetrahydroquinoline-8-carboxamide |
| SMILES | CC(C)C(C)CNC(=O)c1cccc2c1NCCC2 |
| InChI | InChI=1S/C16H24N2O/c1-11(2)12(3)10-18-16(19)14-8-4-6-13-7-5-9-17-15(13)14/h4,6,8,11-12,17H,5,7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | WJQAXAWAWOFXBB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |