C20H20N4S — CID 131893219
1-(dibenzothiophen-4-ylmethyl)-4-(1H-1,2,4-triazol-5-yl)piperidine (PubChem CID 131893219) has the molecular formula C20H20N4S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(dibenzothiophen-4-ylmethyl)-4-(1H-1,2,4-triazol-5-yl)piperidine.
| Compound Name | 1-(dibenzothiophen-4-ylmethyl)-4-(1H-1,2,4-triazol-5-yl)piperidine |
|---|---|
| PubChem CID | 131893219 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(dibenzothiophen-4-ylmethyl)-4-(1H-1,2,4-triazol-5-yl)piperidine |
| SMILES | c1ccc2c(c1)sc1c(CN3CCC(c4ncn[nH]4)CC3)cccc12 |
| InChI | InChI=1S/C20H20N4S/c1-2-7-18-16(5-1)17-6-3-4-15(19(17)25-18)12-24-10-8-14(9-11-24)20-21-13-22-23-20/h1-7,13-14H,8-12H2,(H,21,22,23) |
| InChIKey | XJSVSOIKSRQWGF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |