C20H19ClN4O2 — CID 131893479
N'-(3-chloro-2-methylphenyl)-N-[(2-pyrazol-1-ylphenyl)methyl]propanediamide (PubChem CID 131893479) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is N'-(3-chloro-2-methylphenyl)-N-[(2-pyrazol-1-ylphenyl)methyl]propanediamide.
| Compound Name | N'-(3-chloro-2-methylphenyl)-N-[(2-pyrazol-1-ylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 131893479 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-(3-chloro-2-methylphenyl)-N-[(2-pyrazol-1-ylphenyl)methyl]propanediamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC(=O)NCc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C20H19ClN4O2/c1-14-16(21)7-4-8-17(14)24-20(27)12-19(26)22-13-15-6-2-3-9-18(15)25-11-5-10-23-25/h2-11H,12-13H2,1H3,(H,22,26)(H,24,27) |
| InChIKey | PZFVUEYVTDDTLX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|