C14H14N4O2S2 — CID 131894443
(E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-(1-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethyl)prop-2-enamide (PubChem CID 131894443) has the molecular formula C14H14N4O2S2 and a molecular weight of 334.43 g/mol. Its IUPAC name is (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-(1-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-(1-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 131894443 |
| Molecular Formula | C14H14N4O2S2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-(1-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1cc(CO)cs1)c1cn2ncsc2n1 |
| InChI | InChI=1S/C14H14N4O2S2/c1-9(12-5-18-14(17-12)22-8-15-18)16-13(20)3-2-11-4-10(6-19)7-21-11/h2-5,7-9,19H,6H2,1H3,(H,16,20)/b3-2+ |
| InChIKey | NFLSHXKOJDTUEW-NSCUHMNNSA-N |
| XLogP | 2.24 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|