C21H20N2O3S — CID 131936406
(E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[(4-methoxyphenyl)-pyridin-4-ylmethyl]prop-2-enamide (PubChem CID 131936406) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[(4-methoxyphenyl)-pyridin-4-ylmethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[(4-methoxyphenyl)-pyridin-4-ylmethyl]prop-2-enamide |
|---|---|
| PubChem CID | 131936406 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (E)-3-[4-(hydroxymethyl)thiophen-2-yl]-N-[(4-methoxyphenyl)-pyridin-4-ylmethyl]prop-2-enamide |
| SMILES | COc1ccc(C(NC(=O)/C=C/c2cc(CO)cs2)c2ccncc2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-26-18-4-2-16(3-5-18)21(17-8-10-22-11-9-17)23-20(25)7-6-19-12-15(13-24)14-27-19/h2-12,14,21,24H,13H2,1H3,(H,23,25)/b7-6+ |
| InChIKey | YLYZJOWQXJJUGS-VOTSOKGWSA-N |
| XLogP | 3.56 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|