C22H28N2O3 — CID 131894982
N-[furan-2-yl(phenyl)methyl]-1-morpholin-4-ylcyclohexane-1-carboxamide (PubChem CID 131894982) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-1-morpholin-4-ylcyclohexane-1-carboxamide.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-1-morpholin-4-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 131894982 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-1-morpholin-4-ylcyclohexane-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccco1)C1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H28N2O3/c25-21(22(11-5-2-6-12-22)24-13-16-26-17-14-24)23-20(19-10-7-15-27-19)18-8-3-1-4-9-18/h1,3-4,7-10,15,20H,2,5-6,11-14,16-17H2,(H,23,25) |
| InChIKey | HOIWGLPYYJCCGU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |