C23H33N5O2 — CID 131897369
N-cyclohexyl-4-[3-(2-methylbenzimidazol-1-yl)propanoylamino]piperidine-1-carboxamide (PubChem CID 131897369) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-cyclohexyl-4-[3-(2-methylbenzimidazol-1-yl)propanoylamino]piperidine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[3-(2-methylbenzimidazol-1-yl)propanoylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 131897369 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N-cyclohexyl-4-[3-(2-methylbenzimidazol-1-yl)propanoylamino]piperidine-1-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCC(=O)NC1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-17-24-20-9-5-6-10-21(20)28(17)16-13-22(29)25-19-11-14-27(15-12-19)23(30)26-18-7-3-2-4-8-18/h5-6,9-10,18-19H,2-4,7-8,11-16H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | CIKBURATZCWFHU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |