C20H24ClN5O — CID 131897535
[4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]piperidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 131897535) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]piperidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 131897535 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]piperidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC(N2CCN(c3ncccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C20H24ClN5O/c21-17-4-3-9-23-19(17)25-14-12-24(13-15-25)16-6-10-26(11-7-16)20(27)18-5-1-2-8-22-18/h1-5,8-9,16H,6-7,10-15H2 |
| InChIKey | UZDBKFHDWRHTSA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |