C22H26N4OS — CID 131897594
N-[2-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]methyl]quinolin-6-yl]acetamide (PubChem CID 131897594) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[2-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]methyl]quinolin-6-yl]acetamide.
| Compound Name | N-[2-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]methyl]quinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 131897594 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[2-[[[1-(thiophen-2-ylmethyl)piperidin-3-yl]amino]methyl]quinolin-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2nc(CNC3CCCN(Cc4cccs4)C3)ccc2c1 |
| InChI | InChI=1S/C22H26N4OS/c1-16(27)24-18-8-9-22-17(12-18)6-7-19(25-22)13-23-20-4-2-10-26(14-20)15-21-5-3-11-28-21/h3,5-9,11-12,20,23H,2,4,10,13-15H2,1H3,(H,24,27) |
| InChIKey | ZMFJPJHSQWHYSQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |