C20H26ClN3O2S — CID 131898978
4-[2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 131898978) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is 4-[2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 131898978 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[2-[[1-(3-chloro-4-methylphenyl)piperidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(N2CCC(NCCc3ccc(S(N)(=O)=O)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C20H26ClN3O2S/c1-15-2-5-18(14-20(15)21)24-12-9-17(10-13-24)23-11-8-16-3-6-19(7-4-16)27(22,25)26/h2-7,14,17,23H,8-13H2,1H3,(H2,22,25,26) |
| InChIKey | AXNDOQRHALCBIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |