C23H27F3N4O2 — CID 131899215
1-[4-oxo-4-[4-[2-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]butyl]piperidin-2-one (PubChem CID 131899215) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-[4-oxo-4-[4-[2-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]butyl]piperidin-2-one.
| Compound Name | 1-[4-oxo-4-[4-[2-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]butyl]piperidin-2-one |
|---|---|
| PubChem CID | 131899215 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[4-oxo-4-[4-[2-(trifluoromethyl)quinolin-4-yl]piperazin-1-yl]butyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CCCC(=O)N1CCN(c2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C23H27F3N4O2/c24-23(25,26)20-16-19(17-6-1-2-7-18(17)27-20)28-12-14-30(15-13-28)22(32)9-5-11-29-10-4-3-8-21(29)31/h1-2,6-7,16H,3-5,8-15H2 |
| InChIKey | NEOPUYHWQHLMIM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |