C20H18F3N3O2S — CID 2822622
4-[4-(benzenesulfonyl)piperazin-1-yl]-2-(trifluoromethyl)quinoline (PubChem CID 2822622) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-(trifluoromethyl)quinoline.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 2822622 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-2-(trifluoromethyl)quinoline |
| SMILES | O=S(=O)(c1ccccc1)N1CCN(c2cc(C(F)(F)F)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H18F3N3O2S/c21-20(22,23)19-14-18(16-8-4-5-9-17(16)24-19)25-10-12-26(13-11-25)29(27,28)15-6-2-1-3-7-15/h1-9,14H,10-13H2 |
| InChIKey | KBRJXYXNKYOSFK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |