C23H35N3O4 — CID 131899906
8-acetyl-1-(6-methoxyhexanoyl)-7-phenyl-1,4,8-triazacycloundecan-5-one (PubChem CID 131899906) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 8-acetyl-1-(6-methoxyhexanoyl)-7-phenyl-1,4,8-triazacycloundecan-5-one.
| Compound Name | 8-acetyl-1-(6-methoxyhexanoyl)-7-phenyl-1,4,8-triazacycloundecan-5-one |
|---|---|
| PubChem CID | 131899906 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 8-acetyl-1-(6-methoxyhexanoyl)-7-phenyl-1,4,8-triazacycloundecan-5-one |
| SMILES | COCCCCCC(=O)N1CCCN(C(C)=O)C(c2ccccc2)CC(=O)NCC1 |
| InChI | InChI=1S/C23H35N3O4/c1-19(27)26-15-9-14-25(23(29)12-7-4-8-17-30-2)16-13-24-22(28)18-21(26)20-10-5-3-6-11-20/h3,5-6,10-11,21H,4,7-9,12-18H2,1-2H3,(H,24,28) |
| InChIKey | PFAZUQFTSKVSGD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|