C12H24N4O2S — CID 131900433
N-[(1-ethyl-5-methylpyrazol-4-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine (PubChem CID 131900433) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is N-[(1-ethyl-5-methylpyrazol-4-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine.
| Compound Name | N-[(1-ethyl-5-methylpyrazol-4-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 131900433 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-[(1-ethyl-5-methylpyrazol-4-yl)methyl-methylsulfamoyl]-N-methylpropan-2-amine |
| SMILES | CCn1ncc(CN(C)S(=O)(=O)N(C)C(C)C)c1C |
| InChI | InChI=1S/C12H24N4O2S/c1-7-16-11(4)12(8-13-16)9-14(5)19(17,18)15(6)10(2)3/h8,10H,7,9H2,1-6H3 |
| InChIKey | OLBNOKYLRHJHAR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |