C22H24N4O3 — CID 131903163
N-(oxolan-2-ylmethyl)-N-(2-phenoxyethyl)-2-(1,2,4-triazol-1-yl)benzamide (PubChem CID 131903163) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-(2-phenoxyethyl)-2-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-(2-phenoxyethyl)-2-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 131903163 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-(2-phenoxyethyl)-2-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(c1ccccc1-n1cncn1)N(CCOc1ccccc1)CC1CCCO1 |
| InChI | InChI=1S/C22H24N4O3/c27-22(20-10-4-5-11-21(20)26-17-23-16-24-26)25(15-19-9-6-13-28-19)12-14-29-18-7-2-1-3-8-18/h1-5,7-8,10-11,16-17,19H,6,9,12-15H2 |
| InChIKey | KHKHUALSGKVWKW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |