C13H20ClNO2 — CID 131905273
1-[(5-chlorofuran-2-yl)methyl]-6,6-dimethylazepan-4-ol (PubChem CID 131905273) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-[(5-chlorofuran-2-yl)methyl]-6,6-dimethylazepan-4-ol.
| Compound Name | 1-[(5-chlorofuran-2-yl)methyl]-6,6-dimethylazepan-4-ol |
|---|---|
| PubChem CID | 131905273 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[(5-chlorofuran-2-yl)methyl]-6,6-dimethylazepan-4-ol |
| SMILES | CC1(C)CC(O)CCN(Cc2ccc(Cl)o2)C1 |
| InChI | InChI=1S/C13H20ClNO2/c1-13(2)7-10(16)5-6-15(9-13)8-11-3-4-12(14)17-11/h3-4,10,16H,5-9H2,1-2H3 |
| InChIKey | DSCQDBSJQINNRY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |