C14H26N4O3 — CID 154910003
1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-6,6-dimethylazepan-4-ol;formic acid (PubChem CID 154910003) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-6,6-dimethylazepan-4-ol;formic acid.
| Compound Name | 1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-6,6-dimethylazepan-4-ol;formic acid |
|---|---|
| PubChem CID | 154910003 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]-6,6-dimethylazepan-4-ol;formic acid |
| SMILES | CCc1n[nH]c(CN2CCC(O)CC(C)(C)C2)n1.O=CO |
| InChI | InChI=1S/C13H24N4O.CH2O2/c1-4-11-14-12(16-15-11)8-17-6-5-10(18)7-13(2,3)9-17;2-1-3/h10,18H,4-9H2,1-3H3,(H,14,15,16);1H,(H,2,3) |
| InChIKey | OTQNMGHINNADNQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|