C16H20Cl2N4O3 — CID 163340417
2-(3,4-dichlorophenyl)-4-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]morpholine;formic acid (PubChem CID 163340417) has the molecular formula C16H20Cl2N4O3 and a molecular weight of 387.27 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]morpholine;formic acid.
| Compound Name | 2-(3,4-dichlorophenyl)-4-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]morpholine;formic acid |
|---|---|
| PubChem CID | 163340417 |
| Molecular Formula | C16H20Cl2N4O3 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]morpholine;formic acid |
| SMILES | CCc1n[nH]c(CN2CCOC(c3ccc(Cl)c(Cl)c3)C2)n1.O=CO |
| InChI | InChI=1S/C15H18Cl2N4O.CH2O2/c1-2-14-18-15(20-19-14)9-21-5-6-22-13(8-21)10-3-4-11(16)12(17)7-10;2-1-3/h3-4,7,13H,2,5-6,8-9H2,1H3,(H,18,19,20);1H,(H,2,3) |
| InChIKey | ZURZDYTVHDPYSG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|