C17H28N2 — CID 131905999
N-ethyl-2-phenyl-N-(2-pyrrolidin-1-ylethyl)propan-1-amine (PubChem CID 131905999) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N-ethyl-2-phenyl-N-(2-pyrrolidin-1-ylethyl)propan-1-amine.
| Compound Name | N-ethyl-2-phenyl-N-(2-pyrrolidin-1-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 131905999 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-ethyl-2-phenyl-N-(2-pyrrolidin-1-ylethyl)propan-1-amine |
| SMILES | CCN(CCN1CCCC1)CC(C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2/c1-3-18(13-14-19-11-7-8-12-19)15-16(2)17-9-5-4-6-10-17/h4-6,9-10,16H,3,7-8,11-15H2,1-2H3 |
| InChIKey | YDJASSFUOQTYME-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |