C22H23ClN2O3 — CID 131906342
N-[4-(2-chlorophenoxy)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 131906342) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(2-chlorophenoxy)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 131906342 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[4-(2-chlorophenoxy)phenyl]-1-cyclopentyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2Cl)cc1)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C22H23ClN2O3/c23-19-7-3-4-8-20(19)28-18-11-9-16(10-12-18)24-22(27)15-13-21(26)25(14-15)17-5-1-2-6-17/h3-4,7-12,15,17H,1-2,5-6,13-14H2,(H,24,27) |
| InChIKey | AIVBACUAXSXEFO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |