C21H23N3O3 — CID 131907095
N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-(1-methylindol-3-yl)acetamide (PubChem CID 131907095) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-(1-methylindol-3-yl)acetamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-(1-methylindol-3-yl)acetamide |
|---|---|
| PubChem CID | 131907095 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-3-yl]-2-(1-methylindol-3-yl)acetamide |
| SMILES | Cn1cc(CC(=O)NC2CCCN(C(=O)c3ccco3)C2)c2ccccc21 |
| InChI | InChI=1S/C21H23N3O3/c1-23-13-15(17-7-2-3-8-18(17)23)12-20(25)22-16-6-4-10-24(14-16)21(26)19-9-5-11-27-19/h2-3,5,7-9,11,13,16H,4,6,10,12,14H2,1H3,(H,22,25) |
| InChIKey | PYRSFKAOIGKJGO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |