C16H23N3O3S2 — CID 131907404
3-[5-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 131907404) has the molecular formula C16H23N3O3S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-[5-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 131907404 |
| Molecular Formula | C16H23N3O3S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[5-[(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)methyl]thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | O=S(=O)(N1CCCC1)N1CCN(Cc2cc(C#CCO)cs2)CC1 |
| InChI | InChI=1S/C16H23N3O3S2/c20-11-3-4-15-12-16(23-14-15)13-17-7-9-19(10-8-17)24(21,22)18-5-1-2-6-18/h12,14,20H,1-2,5-11,13H2 |
| InChIKey | RKXXNBICGKQXKP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|