C23H23N3O5 — CID 131907567
N-[2-[[1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]phenyl]-2-methylfuran-3-carboxamide (PubChem CID 131907567) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is N-[2-[[1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[2-[[1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 131907567 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-[[1-(furan-2-carbonyl)piperidin-3-yl]carbamoyl]phenyl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)Nc1ccccc1C(=O)NC1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C23H23N3O5/c1-15-17(10-13-30-15)21(27)25-19-8-3-2-7-18(19)22(28)24-16-6-4-11-26(14-16)23(29)20-9-5-12-31-20/h2-3,5,7-10,12-13,16H,4,6,11,14H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | OQCHSVATWHYVCD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |