C25H31N3O4 — CID 46104197
1-(furan-2-carbonyl)-N-[(2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]piperidine-3-carboxamide (PubChem CID 46104197) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-[(2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]piperidine-3-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-[(2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46104197 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-[(2R)-2-[(2-methylbenzoyl)amino]cyclohexyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1C(=O)N[C@@H]1CCCCC1NC(=O)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C25H31N3O4/c1-17-8-2-3-10-19(17)24(30)27-21-12-5-4-11-20(21)26-23(29)18-9-6-14-28(16-18)25(31)22-13-7-15-32-22/h2-3,7-8,10,13,15,18,20-21H,4-6,9,11-12,14,16H2,1H3,(H,26,29)(H,27,30)/t18?,20?,21-/m1/s1 |
| InChIKey | HANMZIKUIBSEKR-DQVLVPHSSA-N |
| XLogP | 3.30 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |