About 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol
2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol (PubChem CID 131908924) has the molecular formula C18H21FN4O
and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol |
| PubChem CID | 131908924 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol |
| SMILES | Cc1cc(C)n2ncc(CN(CCO)Cc3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C18H21FN4O/c1-13-9-14(2)23-18(21-13)16(10-20-23)12-22(7-8-24)11-15-3-5-17(19)6-4-15/h3-6,9-10,24H,7-8,11-12H2,1-2H3 |
| InChIKey | XMUYDAMUBHLXNG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol?
The IUPAC name of 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol (CID 131908924) is 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol.
What is the SMILES notation for 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol?
The canonical SMILES for 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol is Cc1cc(C)n2ncc(CN(CCO)Cc3ccc(F)cc3)c2n1.
What is the InChIKey of 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol?
The InChIKey is XMUYDAMUBHLXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN4O/c1-13-9-14(2)23-18(21-13)16(10-20-23)12-22(7-8-24)11-15-3-5-17(19)6-4-15/h3-6,9-10,24H,7-8,11-12H2,1-2H3.
What are the key properties of 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol?
2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol has a molecular weight of 328.39 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl-[(4-fluorophenyl)methyl]amino]ethanol is sourced from PubChem (CID 131908924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).