C29H33N5O5 — CID 131910050
(10R,15S)-13-(2-imidazol-1-ylacetyl)-19-methyl-2,9-dioxa-13,16,19-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,20-dione (PubChem CID 131910050) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is (10R,15S)-13-(2-imidazol-1-ylacetyl)-19-methyl-2,9-dioxa-13,16,19-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,20-dione.
| Compound Name | (10R,15S)-13-(2-imidazol-1-ylacetyl)-19-methyl-2,9-dioxa-13,16,19-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,20-dione |
|---|---|
| PubChem CID | 131910050 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | (10R,15S)-13-(2-imidazol-1-ylacetyl)-19-methyl-2,9-dioxa-13,16,19-triazatetracyclo[21.3.1.13,7.010,15]octacosa-1(26),3,5,7(28),23(27),24-hexaene-17,20-dione |
| SMILES | CN1CC(=O)N[C@H]2CN(C(=O)Cn3ccnc3)CC[C@H]2OCc2cccc(c2)Oc2cccc(c2)CCC1=O |
| InChI | InChI=1S/C29H33N5O5/c1-32-17-27(35)31-25-16-34(29(37)18-33-13-11-30-20-33)12-10-26(25)38-19-22-5-3-7-24(15-22)39-23-6-2-4-21(14-23)8-9-28(32)36/h2-7,11,13-15,20,25-26H,8-10,12,16-19H2,1H3,(H,31,35)/t25-,26+/m0/s1 |
| InChIKey | FABNNVMDXBIFPP-IZZNHLLZSA-N |
| XLogP | 2.38 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |