C27H30N4O5 — CID 131921436
(10R,15S)-13-(2-imidazol-1-ylacetyl)-23-methoxy-2,9-dioxa-13,16-diazatetracyclo[18.3.1.13,7.010,15]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-17-one (PubChem CID 131921436) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is (10R,15S)-13-(2-imidazol-1-ylacetyl)-23-methoxy-2,9-dioxa-13,16-diazatetracyclo[18.3.1.13,7.010,15]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-17-one.
| Compound Name | (10R,15S)-13-(2-imidazol-1-ylacetyl)-23-methoxy-2,9-dioxa-13,16-diazatetracyclo[18.3.1.13,7.010,15]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-17-one |
|---|---|
| PubChem CID | 131921436 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | (10R,15S)-13-(2-imidazol-1-ylacetyl)-23-methoxy-2,9-dioxa-13,16-diazatetracyclo[18.3.1.13,7.010,15]pentacosa-1(23),3,5,7(25),20(24),21-hexaen-17-one |
| SMILES | COc1ccc2cc1Oc1cccc(c1)CO[C@@H]1CCN(C(=O)Cn3ccnc3)C[C@@H]1NC(=O)CC2 |
| InChI | InChI=1S/C27H30N4O5/c1-34-24-7-5-19-6-8-26(32)29-22-15-31(27(33)16-30-12-10-28-18-30)11-9-23(22)35-17-20-3-2-4-21(13-20)36-25(24)14-19/h2-5,7,10,12-14,18,22-23H,6,8-9,11,15-17H2,1H3,(H,29,32)/t22-,23+/m0/s1 |
| InChIKey | VERVLMZRKCGFAL-XZOQPEGZSA-N |
| XLogP | 2.93 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |