C31H41N3O6 — CID 131903539
(10R,15S)-13-(cyclobutanecarbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one (PubChem CID 131903539) has the molecular formula C31H41N3O6 and a molecular weight of 551.68 g/mol. Its IUPAC name is (10R,15S)-13-(cyclobutanecarbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one.
| Compound Name | (10R,15S)-13-(cyclobutanecarbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
|---|---|
| PubChem CID | 131903539 |
| Molecular Formula | C31H41N3O6 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | (10R,15S)-13-(cyclobutanecarbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)C3CCC3)CC[C@H]2OCc2cccc(c2)Oc2cc(ccc2OC)C1 |
| InChI | InChI=1S/C31H41N3O6/c1-37-15-5-13-33-18-22-10-11-28(38-2)29(17-22)40-25-9-3-6-23(16-25)21-39-27-12-14-34(31(36)24-7-4-8-24)19-26(27)32-30(35)20-33/h3,6,9-11,16-17,24,26-27H,4-5,7-8,12-15,18-21H2,1-2H3,(H,32,35)/t26-,27+/m0/s1 |
| InChIKey | BAENDGHVBCCZSP-RRPNLBNLSA-N |
| XLogP | 3.74 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|