C30H37N5O6S — CID 131921985
(10R,15S)-13-(2-amino-1,3-thiazole-4-carbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one (PubChem CID 131921985) has the molecular formula C30H37N5O6S and a molecular weight of 595.72 g/mol. Its IUPAC name is (10R,15S)-13-(2-amino-1,3-thiazole-4-carbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one.
| Compound Name | (10R,15S)-13-(2-amino-1,3-thiazole-4-carbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
|---|---|
| PubChem CID | 131921985 |
| Molecular Formula | C30H37N5O6S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (10R,15S)-13-(2-amino-1,3-thiazole-4-carbonyl)-24-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)c3csc(N)n3)CC[C@H]2OCc2cccc(c2)Oc2cc(ccc2OC)C1 |
| InChI | InChI=1S/C30H37N5O6S/c1-38-12-4-10-34-15-20-7-8-26(39-2)27(14-20)41-22-6-3-5-21(13-22)18-40-25-9-11-35(16-23(25)32-28(36)17-34)29(37)24-19-42-30(31)33-24/h3,5-8,13-14,19,23,25H,4,9-12,15-18H2,1-2H3,(H2,31,33)(H,32,36)/t23-,25+/m0/s1 |
| InChIKey | WUYBKKZGDFRBMC-UKILVPOCSA-N |
| XLogP | 3.29 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|