C32H43N3O7 — CID 131911368
(10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(oxane-4-carbonyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one (PubChem CID 131911368) has the molecular formula C32H43N3O7 and a molecular weight of 581.71 g/mol. Its IUPAC name is (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(oxane-4-carbonyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one.
| Compound Name | (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(oxane-4-carbonyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
|---|---|
| PubChem CID | 131911368 |
| Molecular Formula | C32H43N3O7 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(oxane-4-carbonyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)C3CCOCC3)CC[C@H]2OCc2cccc(c2)Oc2cc(ccc2OC)C1 |
| InChI | InChI=1S/C32H43N3O7/c1-38-14-4-12-34-19-23-7-8-29(39-2)30(18-23)42-26-6-3-5-24(17-26)22-41-28-9-13-35(20-27(28)33-31(36)21-34)32(37)25-10-15-40-16-11-25/h3,5-8,17-18,25,27-28H,4,9-16,19-22H2,1-2H3,(H,33,36)/t27-,28+/m0/s1 |
| InChIKey | YHNZVUPWXFOAEZ-WUFINQPMSA-N |
| XLogP | 3.37 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|