C32H40N4O5 — CID 131892439
(10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(pyridin-3-ylmethyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one (PubChem CID 131892439) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(pyridin-3-ylmethyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one.
| Compound Name | (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(pyridin-3-ylmethyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
|---|---|
| PubChem CID | 131892439 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | (10R,15S)-24-methoxy-19-(3-methoxypropyl)-13-(pyridin-3-ylmethyl)-2,9-dioxa-13,16,19-triazatetracyclo[19.3.1.13,7.010,15]hexacosa-1(24),3,5,7(26),21(25),22-hexaen-17-one |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(Cc3cccnc3)CC[C@H]2OCc2cccc(c2)Oc2cc(ccc2OC)C1 |
| InChI | InChI=1S/C32H40N4O5/c1-38-15-5-13-35-19-24-9-10-30(39-2)31(17-24)41-27-8-3-6-25(16-27)23-40-29-11-14-36(20-26-7-4-12-33-18-26)21-28(29)34-32(37)22-35/h3-4,6-10,12,16-18,28-29H,5,11,13-15,19-23H2,1-2H3,(H,34,37)/t28-,29+/m0/s1 |
| InChIKey | FWRLZBPJTSFHBN-URLMMPGGSA-N |
| XLogP | 4.01 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|