C34H45N3O7 — CID 131910472
(10R,15S)-13-(2-cyclobutylacetyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione (PubChem CID 131910472) has the molecular formula C34H45N3O7 and a molecular weight of 607.75 g/mol. Its IUPAC name is (10R,15S)-13-(2-cyclobutylacetyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione.
| Compound Name | (10R,15S)-13-(2-cyclobutylacetyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione |
|---|---|
| PubChem CID | 131910472 |
| Molecular Formula | C34H45N3O7 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | (10R,15S)-13-(2-cyclobutylacetyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)CC3CCC3)CC[C@H]2OCc2cccc(c2)Oc2ccc(cc2OC)CCC1=O |
| InChI | InChI=1S/C34H45N3O7/c1-41-17-5-15-36-22-32(38)35-28-21-37(34(40)20-24-6-3-7-24)16-14-29(28)43-23-26-8-4-9-27(18-26)44-30-12-10-25(11-13-33(36)39)19-31(30)42-2/h4,8-10,12,18-19,24,28-29H,3,5-7,11,13-17,20-23H2,1-2H3,(H,35,38)/t28-,29+/m0/s1 |
| InChIKey | XSAHWDRPLRPIIS-URLMMPGGSA-N |
| XLogP | 4.09 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|