C36H40N4O7 — CID 131947024
2-[(10R,15S)-25-methoxy-19-(3-methoxypropyl)-17,20-dioxo-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-13-carbonyl]benzonitrile (PubChem CID 131947024) has the molecular formula C36H40N4O7 and a molecular weight of 640.74 g/mol. Its IUPAC name is 2-[(10R,15S)-25-methoxy-19-(3-methoxypropyl)-17,20-dioxo-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-13-carbonyl]benzonitrile.
| Compound Name | 2-[(10R,15S)-25-methoxy-19-(3-methoxypropyl)-17,20-dioxo-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-13-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 131947024 |
| Molecular Formula | C36H40N4O7 |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 2-[(10R,15S)-25-methoxy-19-(3-methoxypropyl)-17,20-dioxo-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-13-carbonyl]benzonitrile |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)c3ccccc3C#N)CC[C@H]2OCc2cccc(c2)Oc2ccc(cc2OC)CCC1=O |
| InChI | InChI=1S/C36H40N4O7/c1-44-18-6-16-39-23-34(41)38-30-22-40(36(43)29-10-4-3-8-27(29)21-37)17-15-31(30)46-24-26-7-5-9-28(19-26)47-32-13-11-25(12-14-35(39)42)20-33(32)45-2/h3-5,7-11,13,19-20,30-31H,6,12,14-18,22-24H2,1-2H3,(H,38,41)/t30-,31+/m0/s1 |
| InChIKey | PKDXAVUHKSAZEB-IOWSJCHKSA-N |
| XLogP | 4.09 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|