C34H43N5O7 — CID 131898670
(10R,15S)-13-(1,3-dimethylpyrazole-4-carbonyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione (PubChem CID 131898670) has the molecular formula C34H43N5O7 and a molecular weight of 633.75 g/mol. Its IUPAC name is (10R,15S)-13-(1,3-dimethylpyrazole-4-carbonyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione.
| Compound Name | (10R,15S)-13-(1,3-dimethylpyrazole-4-carbonyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione |
|---|---|
| PubChem CID | 131898670 |
| Molecular Formula | C34H43N5O7 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | (10R,15S)-13-(1,3-dimethylpyrazole-4-carbonyl)-25-methoxy-19-(3-methoxypropyl)-2,9-dioxa-13,16,19-triazatetracyclo[21.2.2.13,7.010,15]octacosa-1(25),3,5,7(28),23,26-hexaene-17,20-dione |
| SMILES | COCCCN1CC(=O)N[C@H]2CN(C(=O)c3cn(C)nc3C)CC[C@H]2OCc2cccc(c2)Oc2ccc(cc2OC)CCC1=O |
| InChI | InChI=1S/C34H43N5O7/c1-23-27(19-37(2)36-23)34(42)39-15-13-29-28(20-39)35-32(40)21-38(14-6-16-43-3)33(41)12-10-24-9-11-30(31(18-24)44-4)46-26-8-5-7-25(17-26)22-45-29/h5,7-9,11,17-19,28-29H,6,10,12-16,20-22H2,1-4H3,(H,35,40)/t28-,29+/m0/s1 |
| InChIKey | IAMFIWHDOGSCBS-URLMMPGGSA-N |
| XLogP | 3.26 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|