C13H25N3O4S — CID 131910183
N-[2-[methyl(methylsulfonyl)amino]ethyl]-4-(2-oxopiperidin-1-yl)butanamide (PubChem CID 131910183) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[2-[methyl(methylsulfonyl)amino]ethyl]-4-(2-oxopiperidin-1-yl)butanamide.
| Compound Name | N-[2-[methyl(methylsulfonyl)amino]ethyl]-4-(2-oxopiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 131910183 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-[2-[methyl(methylsulfonyl)amino]ethyl]-4-(2-oxopiperidin-1-yl)butanamide |
| SMILES | CN(CCNC(=O)CCCN1CCCCC1=O)S(C)(=O)=O |
| InChI | InChI=1S/C13H25N3O4S/c1-15(21(2,19)20)11-8-14-12(17)6-5-10-16-9-4-3-7-13(16)18/h3-11H2,1-2H3,(H,14,17) |
| InChIKey | URRZXBMYZZHFKB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |