C31H38N8O6S — CID 131911171
N-[2-[(5R,12S)-12-benzyl-4,11,14-trioxo-3,7,10,13,18,19,20-heptazatricyclo[16.2.1.05,10]henicosa-1(21),19-dien-7-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide (PubChem CID 131911171) has the molecular formula C31H38N8O6S and a molecular weight of 650.76 g/mol. Its IUPAC name is N-[2-[(5R,12S)-12-benzyl-4,11,14-trioxo-3,7,10,13,18,19,20-heptazatricyclo[16.2.1.05,10]henicosa-1(21),19-dien-7-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-[2-[(5R,12S)-12-benzyl-4,11,14-trioxo-3,7,10,13,18,19,20-heptazatricyclo[16.2.1.05,10]henicosa-1(21),19-dien-7-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 131911171 |
| Molecular Formula | C31H38N8O6S |
| Molecular Weight | 650.76 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | N-[2-[(5R,12S)-12-benzyl-4,11,14-trioxo-3,7,10,13,18,19,20-heptazatricyclo[16.2.1.05,10]henicosa-1(21),19-dien-7-yl]-2-oxoethyl]-N-(3-methylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(N(CC(=O)N2CCN3C(=O)[C@H](Cc4ccccc4)NC(=O)CCCn4cc(nn4)CNC(=O)[C@H]3C2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C31H38N8O6S/c1-22-8-6-11-25(16-22)39(46(2,44)45)21-29(41)36-14-15-38-27(20-36)30(42)32-18-24-19-37(35-34-24)13-7-12-28(40)33-26(31(38)43)17-23-9-4-3-5-10-23/h3-6,8-11,16,19,26-27H,7,12-15,17-18,20-21H2,1-2H3,(H,32,42)(H,33,40)/t26-,27+/m0/s1 |
| InChIKey | AQIJTZVMIZPIRJ-RRPNLBNLSA-N |
| XLogP | 0.23 |
| TPSA | 166.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.76 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |