C17H21N5O2 — CID 131902764
(7S)-7-benzyl-1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-6,9-dione (PubChem CID 131902764) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (7S)-7-benzyl-1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-6,9-dione.
| Compound Name | (7S)-7-benzyl-1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-6,9-dione |
|---|---|
| PubChem CID | 131902764 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (7S)-7-benzyl-1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-6,9-dione |
| SMILES | O=C1CCc2cn(nn2)CCCNC(=O)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C17H21N5O2/c23-16-8-7-14-12-22(21-20-14)10-4-9-18-17(24)15(19-16)11-13-5-2-1-3-6-13/h1-3,5-6,12,15H,4,7-11H2,(H,18,24)(H,19,23)/t15-/m0/s1 |
| InChIKey | CEFHMFLNDSMWFV-HNNXBMFYSA-N |
| XLogP | 0.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |