C27H36N6O3 — CID 131942428
(7S)-7-benzyl-1'-(cyclopentanecarbonyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131942428) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-(cyclopentanecarbonyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-(cyclopentanecarbonyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131942428 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | (7S)-7-benzyl-1'-(cyclopentanecarbonyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | O=C1NCCCn2cc(nn2)CC2(CCN(C(=O)C3CCCC3)CC2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H36N6O3/c34-24-23(17-20-7-2-1-3-8-20)29-26(36)27(18-22-19-33(31-30-22)14-6-13-28-24)11-15-32(16-12-27)25(35)21-9-4-5-10-21/h1-3,7-8,19,21,23H,4-6,9-18H2,(H,28,34)(H,29,36)/t23-/m0/s1 |
| InChIKey | YGBGCZKHDJWFNQ-QHCPKHFHSA-N |
| XLogP | 1.87 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |