C28H33ClN6O2 — CID 131907994
(7S)-7-benzyl-1'-[(2-chlorophenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131907994) has the molecular formula C28H33ClN6O2 and a molecular weight of 521.07 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-[(2-chlorophenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-[(2-chlorophenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131907994 |
| Molecular Formula | C28H33ClN6O2 |
| Molecular Weight | 521.07 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (7S)-7-benzyl-1'-[(2-chlorophenyl)methyl]spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | O=C1NCCCn2cc(nn2)CC2(CCN(Cc3ccccc3Cl)CC2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H33ClN6O2/c29-24-10-5-4-9-22(24)19-34-15-11-28(12-16-34)18-23-20-35(33-32-23)14-6-13-30-26(36)25(31-27(28)37)17-21-7-2-1-3-8-21/h1-5,7-10,20,25H,6,11-19H2,(H,30,36)(H,31,37)/t25-/m0/s1 |
| InChIKey | YNESMIBXRHKCBG-VWLOTQADSA-N |
| XLogP | 3.00 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |