C26H36N6O3S — CID 131942049
(7S)-7-benzyl-1'-(3-ethylsulfanylpropanoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione (PubChem CID 131942049) has the molecular formula C26H36N6O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is (7S)-7-benzyl-1'-(3-ethylsulfanylpropanoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione.
| Compound Name | (7S)-7-benzyl-1'-(3-ethylsulfanylpropanoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
|---|---|
| PubChem CID | 131942049 |
| Molecular Formula | C26H36N6O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | (7S)-7-benzyl-1'-(3-ethylsulfanylpropanoyl)spiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione |
| SMILES | CCSCCC(=O)N1CCC2(CC1)Cc1cn(nn1)CCCNC(=O)[C@H](Cc1ccccc1)NC2=O |
| InChI | InChI=1S/C26H36N6O3S/c1-2-36-16-9-23(33)31-14-10-26(11-15-31)18-21-19-32(30-29-21)13-6-12-27-24(34)22(28-25(26)35)17-20-7-4-3-5-8-20/h3-5,7-8,19,22H,2,6,9-18H2,1H3,(H,27,34)(H,28,35)/t22-/m0/s1 |
| InChIKey | FFHUQTLKUZMFOX-QFIPXVFZSA-N |
| XLogP | 1.82 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|