C21H29ClN6O2 — CID 171149432
(7S)-7-benzylspiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione;hydrochloride (PubChem CID 171149432) has the molecular formula C21H29ClN6O2 and a molecular weight of 432.96 g/mol. Its IUPAC name is (7S)-7-benzylspiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione;hydrochloride.
| Compound Name | (7S)-7-benzylspiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione;hydrochloride |
|---|---|
| PubChem CID | 171149432 |
| Molecular Formula | C21H29ClN6O2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (7S)-7-benzylspiro[1,5,8,13,14-pentazabicyclo[10.2.1]pentadeca-12(15),13-diene-10,4'-piperidine]-6,9-dione;hydrochloride |
| SMILES | Cl.O=C1NCCCn2cc(nn2)CC2(CCNCC2)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H28N6O2.ClH/c28-19-18(13-16-5-2-1-3-6-16)24-20(29)21(7-10-22-11-8-21)14-17-15-27(26-25-17)12-4-9-23-19;/h1-3,5-6,15,18,22H,4,7-14H2,(H,23,28)(H,24,29);1H/t18-;/m0./s1 |
| InChIKey | HBRBOIKSHPSSJK-FERBBOLQSA-N |
| XLogP | 0.86 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |